CAS 905811-03-2

N-(5-amino-2-methylphenyl)-3-methylbenzamide

Description:

N-(5-amino-2-methylphenyl)-3-methylbenzamide, with the CAS number 905811-03-2, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a substituted aniline structure, where a 5-amino-2-methylphenyl group is attached to a 3-methylbenzamide moiety. The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including coupling and substitution. The methyl groups in the structure enhance its lipophilicity, which may influence its solubility and biological activity. Additionally, the compound's aromatic rings suggest potential for π-π stacking interactions, which can be relevant in drug design and molecular recognition processes. Overall, N-(5-amino-2-methylphenyl)-3-methylbenzamide exhibits properties typical of aromatic amides, including stability under standard conditions and potential reactivity in organic synthesis.

Formula: C₁₅H₁₆N₂O

InChI: InChI=1/C15H16N2O/c1-10-4-3-5-12(8-10)15(18)17-14-9-13(16)7-6-11(14)2/h3-9H,16H2,1-2H3,(H,17,18)

SMILES: Cc1cccc(c1)C(=Nc1cc(ccc1C)N)O

Synonyms:

• Benzamide, N-(5-amino-2-methylphenyl)-3-methyl-
• N-(5-Amino-2-methylphenyl)-3-methylbenzamide

N-(5-Amino-2-methylphenyl)-3-methylbenzamide

CAS: 905811-03-2

Formula: C₁₅H₁₆N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 240.306

Ref: 10-F039329