CAS 90586-89-3

Pyrimidine, 2-hydrazinyl-4-methyl-, hydrochloride (1:?)

Description:

Pyrimidine, 2-hydrazinyl-4-methyl-, hydrochloride (CAS 90586-89-3) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a hydrazinyl group at the 2-position and a methyl group at the 4-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its molecular structure allows for hydrogen bonding and interactions with biological macromolecules, which can influence its pharmacokinetics and pharmacodynamics. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₈N₄·xClH

InChI: InChI=1S/C5H8N4.ClH/c1-4-2-3-7-5(8-4)9-6;/h2-3H,6H2,1H3,(H,7,8,9);1H

InChI key: InChIKey=PANSVJMJTJFBBG-UHFFFAOYSA-N

SMILES: N(N)=C1NC(C)=CC=N1.Cl

Synonyms:

• Pyrimidine, 2-hydrazinyl-4-methyl-, hydrochloride (1:?)
• Pyrimidine, 2-hydrazino-4-methyl-, hydrochloride