CAS 9060-11-1
:2-({2-[2-{[(6-amino-2-{3-amino-1-[(2,3-diamino-3-oxopropyl)amino]-3-oxopropyl}-5-methylpyrimidin-4-yl)carbonyl]amino}-3-({5-[(1-{[2-(4-{[4-(N-{4-[(diaminomethylidene)amino]butyl}carbamimidamido)butyl]carbamoyl}-2,4'-bi-1,3-thiazol-2'-yl)ethyl]amino}-3-hyd
Description:
The chemical substance with the name provided is a complex organic compound characterized by a multi-functional structure that includes various amino groups, carbonyl functionalities, and a pyrimidine ring. Its molecular architecture suggests it may exhibit significant biological activity, potentially serving as a pharmaceutical agent or a biochemical probe. The presence of multiple amino groups indicates that it may engage in hydrogen bonding and ionic interactions, which could enhance its solubility and reactivity in biological systems. Additionally, the compound's intricate structure, featuring thiazole and pyrimidine moieties, suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. The CAS number 9060-11-1 allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses. Overall, this compound exemplifies the complexity often found in drug design, where structural diversity is key to achieving desired biological effects.
Formula:C60H95N23O21S2
InChI:InChI=1/C60H95N23O21S2/c1-23-36(79-49(82-47(23)63)28(15-34(62)87)74-16-27(61)48(64)93)53(97)81-38(44(29-17-70-22-75-29)102-57-46(42(91)40(89)32(18-84)101-57)103-56-43(92)45(104-60(69)99)41(90)33(19-85)100-56)54(98)76-25(3)39(88)24(2)50(94)80-37(26(4)86)52(96)72-12-9-35-77-31(21-105-35)55-78-30(20-106-55)51(95)71-10-5-7-13-83(59(67)68)14-8-6-11-73-58(65)66/h17,20-22,24-28,32-33,37-46,56-57,74,84-86,88-92H,5-16,18-19,61H2,1-4H3,(H2,62,87)(H2,64,93)(H3,67,68)(H2,69,99)(H,70,75)(H,71,95)(H,72,96)(H,76,98)(H,80,94)(H,81,97)(H2,63,79,82)(H4,65,66,73)
SMILES:Cc1c(C(=NC(C(c2cnc[nH]2)OC2C(C(C(C(CO)O2)O)O)OC2C(C(C(C(CO)O2)O)OC(=N)O)O)C(=NC(C)C(C(C)C(=NC(C(C)O)C(=NCCc2nc(cs2)c2nc(cs2)C(=NCCCCN(CCCCNC(=N)N)C(=N)N)O)O)O)O)O)O)nc(C(CC(=N)O)NCC(C(=N)O)N)[nH]c1=N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Bleomycin B4
CAS:Bleomycin B4 (Phleomycin F), an antibiotic with antitumor properties, is utilized in cancer research [1] [2] [3].Formula:C60H95N23O21S2Color and Shape:SolidMolecular weight:1538.67Ref: 4Z-B-190004
Discontinued product


