CymitQuimica logo

CAS 906000-49-5

:

N-Methyl-1H-indazole-6-carboxamide

Description:
N-Methyl-1H-indazole-6-carboxamide is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methyl group attached to the nitrogen atom at the first position and a carboxamide functional group at the sixth position of the indazole ring. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the carboxamide group contributes to its potential as a bioactive molecule, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit various biological activities, including potential effects on the central nervous system or other physiological pathways, although specific activity profiles would depend on further empirical studies. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity. Its CAS number, 906000-49-5, serves as a unique identifier for regulatory and research purposes.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-10-9(13)6-2-3-7-5-11-12-8(7)4-6/h2-5H,1H3,(H,10,13)(H,11,12)
InChI key:InChIKey=VQQHIPUHIPQFOW-UHFFFAOYSA-N
SMILES:C(NC)(=O)C=1C=C2C(=CC1)C=NN2
Synonyms:
  • 1H-Indazole-6-carboxamide, N-methyl-
  • N-Methyl-1H-indazole-6-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.