CAS 906008-94-4
:N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-methylpropanamide
Description:
N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-methylpropanamide, with the CAS number 906008-94-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a cyano group, trifluoromethyl group, and a sulfonamide moiety. This compound is typically a solid at room temperature and exhibits high stability due to the presence of strong covalent bonds. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies, owing to the presence of functional groups that can interact with biological targets. The trifluoromethyl and fluorophenyl groups may enhance lipophilicity and bioavailability, making it a candidate for drug development. Additionally, the sulfonamide group is known for its role in various biological activities, including antimicrobial properties. The compound's solubility and reactivity can vary based on the solvent and conditions, which are important considerations for its practical applications in research and industry.
Formula:C18H14F4N2O3S
InChI:InChI=1/C18H14F4N2O3S/c1-11(10-28(26,27)15-6-3-13(19)4-7-15)17(25)24-14-5-2-12(9-23)16(8-14)18(20,21)22/h2-8,11H,10H2,1H3,(H,24,25)
SMILES:CC(CS(=O)(=O)c1ccc(cc1)F)C(=Nc1ccc(C#N)c(c1)C(F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Deoxybicalutamide (N-[4-Cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenylsulfonyl)-2-methylpropanamide)
CAS:Other aromatic organo-sulfur compounds (excluding pesticides)Formula:C18H14F4N2O3SColor and Shape:SolidMolecular weight:414.06613Bicalutamide EP Impurity C (Deshydroxy Bicalutamide)
CAS:Formula:C18H14F4N2O3SColor and Shape:White To Off-White SolidMolecular weight:414.37Deshydroxy Bicalutamide
CAS:Controlled Product<p>Impurity Bicalutamide EP Impurity C<br>Applications Deshydroxy Bicalutamide (Bicalutamide EP Impurity C) is an impuirty of Bicalutamide. Bicalutamide intermediate.<br>References Lysiak, V., et al.: Bioorg. Med. Chem., 13, 671 (2005),<br></p>Formula:C18H14F4N2O3SColor and Shape:Off-WhiteMolecular weight:414.37Deshydroxy bicalutamide
CAS:<p>Deshydroxy bicalutamide is a ligand that has been synthesized to bind to the androgen receptor. It is an antagonist of the androgen receptor. Deshydroxy bicalutamide has been shown to inhibit cancer cell growth in prostate cancer cell lines, which is due to its ability to bind and block the ligand-binding domain of the androgen receptor. Molecular modelling has shown that deshydroxy bicalutamide binds in the hydroxyl group region of the binding site, which blocks it from binding with other ligands such as testosterone. This may lead to decreased levels of testosterone in males, leading to decreased levels of androgens in prostate cancer cells.</p>Formula:C18H14F4N2O3SPurity:Min. 95%Molecular weight:414.38 g/mol






