
CAS 90605-01-9
:9-Octadecenoic acid (9Z)-, ester with 2,2′-[oxybis(2,1-ethanediyloxy)]bis[ethanol]
Description:
9-Octadecenoic acid (9Z)-, ester with 2,2′-[oxybis(2,1-ethanediyloxy)]bis[ethanol], commonly known as a type of fatty acid ester, is characterized by its long hydrocarbon chain and unsaturation at the ninth carbon position, which contributes to its fluidity and reactivity. This compound features a hydrophobic tail due to the octadecenoic acid component, while the hydrophilic part consists of the ether and alcohol functionalities from the bis(ethanol) moiety. As a result, it exhibits amphiphilic properties, making it useful in various applications such as emulsifiers, surfactants, and in the formulation of personal care products. The presence of the ester bond indicates that it can undergo hydrolysis under certain conditions, releasing the fatty acid and alcohol components. Additionally, its molecular structure suggests potential for biodegradability, which is an important characteristic in the context of environmental sustainability. Overall, this compound's unique structure imparts specific physical and chemical properties that are valuable in both industrial and consumer applications.
Formula:C18H34O2·xC8H18O5
InChI:InChI=1S/C18H34O2.C8H18O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h9-10H,2-8,11-17H2,1H3,(H,19,20);9-10H,1-8H2/b10-9-;
InChI key:InChIKey=FNSOIIBEUBBAHX-KVVVOXFISA-N
SMILES:C(C/C=C\CCCCCCCC)CCCCCC(O)=O.O(CCOCCO)CCOCCO
Synonyms:- 9-Octadecenoic acid (Z)-, ester with 2,2'-(oxybis(2,1-ethanediyloxy))bis(ethanol)
- 9-Octadecenoic acid (9Z)-, ester with 2,2′-[oxybis(2,1-ethanediyloxy)]bis[ethanol]
- 9-Octadecenoic acid (Z)-, ester with 2,2′-[oxybis(2,1-ethanediyloxy)]bis[ethanol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-Octadecenoic acid (9Z)-, ester with 2,2′-[oxybis(2,1-ethanediyloxy)]bis[ethanol]
CAS:Formula:C26H52O7Molecular weight:476.6869
