
CAS 90605-16-6
:1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 2,2′-[1,2-ethanediylbis(oxy)]bis[ethanol]
Description:
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 2,2′-[1,2-ethanediylbis(oxy)]bis[ethanol], commonly known as a complex ester, is a chemical compound characterized by its multiple carboxylic acid functional groups and hydroxyl groups. This compound typically exhibits properties such as high solubility in polar solvents due to its hydrophilic nature, which is attributed to the presence of hydroxyl and carboxylic acid groups. It may serve as a surfactant or emulsifying agent in various applications, including cosmetics, pharmaceuticals, and food products. The structure suggests potential for chelation and interaction with metal ions, which can enhance its utility in formulations requiring stabilization or preservation. Additionally, the presence of multiple functional groups allows for reactivity in organic synthesis, making it a versatile compound in chemical processes. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper usage and compliance with regulatory standards.
Formula:C6H14O4·xC6H8O7
InChI:InChI=1S/C6H8O7.C6H14O4/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-1-3-9-5-6-10-4-2-8/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);7-8H,1-6H2
InChI key:InChIKey=KEYNXNFBSLKJNI-UHFFFAOYSA-N
SMILES:C(COCCO)OCCO.C(CC(O)=O)(CC(O)=O)(C(O)=O)O
Synonyms:- 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 2,2′-[1,2-ethanediylbis(oxy)]bis[ethanol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, ester with 2,2′-[1,2-ethanediylbis(oxy)]bis[ethanol]
CAS:Formula:C12H22O11Molecular weight:342.2965
