CAS 906079-63-8

3-(Methylsulfanyl)propyl hexanoate

Description:

3-(Methylsulfanyl)propyl hexanoate, with the CAS number 906079-63-8, is an organic compound characterized by its ester functional group, which is formed from the reaction of hexanoic acid and 3-(methylsulfanyl)propan-1-ol. This compound features a propyl chain with a methylsulfanyl group, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a characteristic odor, indicative of its ester nature. The presence of the methylsulfanyl group can impart distinct sensory characteristics, potentially making it useful in flavor and fragrance applications. In terms of solubility, esters like this one are generally soluble in organic solvents but may have limited solubility in water. The compound's stability and reactivity can be influenced by the presence of the sulfur atom, which may participate in various chemical reactions. Overall, 3-(Methylsulfanyl)propyl hexanoate is of interest in both industrial applications and research, particularly in the fields of organic synthesis and materials science.

Formula: C₁₀H₂₀O₂S

InChI: InChI=1/C10H20O2S/c1-3-4-5-7-10(11)12-8-6-9-13-2/h3-9H2,1-2H3

SMILES: CCCCCC(=O)OCCCSC

Synonyms:

• Hexanoic Acid, 3-(Methylthio)Propyl Ester