CAS 90609-48-6

α-Ethyl-4-iodobenzenemethanol

Description:

α-Ethyl-4-iodobenzenemethanol, with the CAS number 90609-48-6, is an organic compound characterized by its structure, which includes an ethyl group, an iodine atom, and a hydroxymethyl group attached to a benzene ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential reactivity due to the presence of the iodine atom, which can participate in nucleophilic substitution reactions. The hydroxymethyl group contributes to its polarity, making it more soluble in polar solvents compared to non-polar solvents. Additionally, the presence of the iodine atom can enhance the compound's reactivity in various chemical transformations, such as coupling reactions or as a leaving group in substitution reactions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Overall, α-Ethyl-4-iodobenzenemethanol is a versatile compound with applications in organic synthesis and potential implications in pharmaceutical research.

Formula: C₉H₁₁IO

InChI: InChI=1S/C9H11IO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6,9,11H,2H2,1H3

InChI key: InChIKey=WHVOBMQSOGUJIK-UHFFFAOYSA-N

SMILES: C(CC)(O)C1=CC=C(I)C=C1

Synonyms:

• Benzyl alcohol, α-ethyl-p-iodo-
• α-Ethyl-4-iodobenzenemethanol
• 1-(4-Iodophenyl)-1-propanol
• Benzenemethanol, α-ethyl-4-iodo-