CAS 90610-08-5
:Ethyl 3-(1H-pyrrol-2-yl)-2-propenoate
Description:
Ethyl 3-(1H-pyrrol-2-yl)-2-propenoate, with the CAS number 90610-08-5, is an organic compound characterized by its ester functional group and a pyrrole ring. This compound features a propenoate moiety, which contributes to its reactivity, particularly in polymerization and other chemical transformations. Ethyl 3-(1H-pyrrol-2-yl)-2-propenoate is typically a colorless to pale yellow liquid, exhibiting a pleasant odor. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic nature. The presence of the pyrrole ring imparts unique electronic properties, making it of interest in various applications, including organic synthesis and materials science. Additionally, this compound may exhibit biological activity, which could be explored for potential pharmaceutical applications. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-2-12-9(11)6-5-8-4-3-7-10-8/h3-7,10H,2H2,1H3
InChI key:InChIKey=LRQXFCIRPHLXFH-UHFFFAOYSA-N
SMILES:C(=CC(OCC)=O)C1=CC=CN1
Synonyms:- 2-Propenoic acid, 3-(1H-pyrrol-2-yl)-, ethyl ester
- Pyrrole-2-acrylic acid, ethyl ester
- Ethyl 3-(1H-pyrrol-2-yl)-2-propenoate
- 3-Pyrrol-2-yl-acrylic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.