CAS 90611-37-3
:S-bicyclo[2.2.1]hept-2-yl ethanethioate
Description:
S-bicyclo[2.2.1]hept-2-yl ethanethioate, with the CAS number 90611-37-3, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework. This compound features a thioester functional group, specifically an ethanethioate, which contributes to its reactivity and potential applications in organic synthesis. The presence of sulfur in the thioate group imparts unique chemical properties, such as the ability to participate in nucleophilic substitution reactions. The bicyclic structure provides rigidity and can influence the compound's physical properties, such as boiling point and solubility. Additionally, the stereochemistry of the bicyclo framework can affect its interactions with biological systems, making it of interest in medicinal chemistry. Overall, S-bicyclo[2.2.1]hept-2-yl ethanethioate is a compound that exemplifies the diverse chemistry of bicyclic systems and thioesters, with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C9H14OS
InChI:InChI=1/C9H14OS/c1-6(10)11-9-5-7-2-3-8(9)4-7/h7-9H,2-5H2,1H3
SMILES:CC(=O)SC1CC2CCC1C2
Synonyms:- Thioacetic acid, S-bicyclo[2.2.1]hept-2-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Norbornanethiol Acetate
CAS:Controlled ProductFormula:C9H14OSColor and Shape:NeatMolecular weight:170.272

