CymitQuimica logo

CAS 90617-76-8

:

1-(2,4,5-Trichlorophenyl)-2-thiourea

Description:
1-(2,4,5-Trichlorophenyl)-2-thiourea, with the CAS number 90617-76-8, is an organic compound characterized by the presence of a thiourea functional group and a trichlorophenyl moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including agriculture as a pesticide or herbicide, due to its biological activity. The presence of three chlorine atoms on the phenyl ring significantly influences its chemical properties, enhancing its reactivity and lipophilicity. It may exhibit moderate to high toxicity to aquatic organisms and other non-target species, necessitating careful handling and regulation. Additionally, the compound's structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and environmental studies. As with many thiourea derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 1-(2,4,5-Trichlorophenyl)-2-thiourea is a compound of interest due to its unique structural features and potential applications.
Formula:C7H5Cl3N2S
InChI:InChI=1/C7H5Cl3N2S/c8-3-1-5(10)6(2-4(3)9)12-7(11)13/h1-2H,(H3,11,12,13)
SMILES:c1c(c(cc(c1Cl)NC(=N)S)Cl)Cl
Synonyms:
  • 1-(2,4,5-Trichlorophenyl)Thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.