CAS 9063-57-4
:threonyllysylprolyl-N~5~-(diaminomethylidene)ornithine
Description:
Threonyllysylprolyl-N~5~-(diaminomethylidene)ornithine, identified by its CAS number 9063-57-4, is a synthetic peptide that consists of a sequence of amino acids, specifically threonine, lysine, proline, and ornithine, with a diaminomethylidene group. This compound is characterized by its potential biological activity, particularly in the context of peptide synthesis and medicinal chemistry. The presence of the diaminomethylidene moiety may enhance its interaction with biological targets, potentially influencing its pharmacological properties. Peptides like this one often exhibit unique solubility profiles, stability, and reactivity due to their specific amino acid composition and structure. They can play roles in various biochemical processes, including signaling pathways and enzyme regulation. Additionally, the structural features of this compound may allow for modifications that can tailor its activity for specific applications in drug development or therapeutic interventions. Overall, threonyllysylprolyl-N~5~-(diaminomethylidene)ornithine represents a complex molecule with potential implications in biochemistry and pharmacology.
Formula:C21H40N8O6
InChI:InChI=1/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)
SMILES:CC(C(C(=NC(CCCCN)C(=O)N1CCCC1C(=NC(CCCNC(=N)N)C(=O)O)O)O)N)O
Synonyms:- Tuftsin
- H-Thr-Lys-Pro-Arg-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tuftsin
CAS:Tuftsin is a natural immunomodulating peptide originally found as a phagocytosis-stimulating factor for polymorphonuclear leukocytes. The peptide is now known to elicit various other activities including antimicrobial, antiviral and antitumor effects in vivo.Formula:C21H40N8O6Purity:98.4%Color and Shape:White PowderMolecular weight:500.6Tuftsin
CAS:<p>Tuftsin (Tuftsin(3TFA)) is a natural activator of Phagocyte Cells</p>Formula:C21H40N8O6Purity:99.99%Color and Shape:SolidMolecular weight:500.59Tuftsin
CAS:<p>Tuftsin is a ligand with the ability to activate specific receptors. It is also known as Activator, and is a reagent that can be used in research for cell biology and pharmacology. Tuftsin has been shown to bind to ion channels and act as an inhibitor of these channels. This activity leads to the inhibition of calcium influx into cells, which may be important for regulating cellular processes such as apoptosis, cytoskeletal rearrangement, or protein synthesis. It may also play a role in immune response pathways.</p>Formula:C21H40N8O6Purity:Min. 95%Molecular weight:500.6 g/mol



