CAS 906352-64-5
:N-methyl-1-[2-(1H-1,2,4-triazol-1-ylmethyl)phenyl]methanamine
Description:
N-methyl-1-[2-(1H-1,2,4-triazol-1-ylmethyl)phenyl]methanamine, with the CAS number 906352-64-5, is a chemical compound characterized by its complex structure, which includes a triazole ring and an amine group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine functional group. The triazole moiety contributes to its biological activity, often enhancing its interaction with biological targets, making it of interest in pharmaceutical research. The presence of the methyl group on the nitrogen atom can influence its lipophilicity and overall pharmacokinetic properties. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, N-methyl-1-[2-(1H-1,2,4-triazol-1-ylmethyl)phenyl]methanamine represents a unique structure with potential applications in medicinal chemistry and related fields.
Formula:C11H14N4
InChI:InChI=1/C11H14N4/c1-12-6-10-4-2-3-5-11(10)7-15-9-13-8-14-15/h2-5,8-9,12H,6-7H2,1H3
SMILES:CNCc1ccccc1Cn1cncn1
Synonyms:- N-methyl-2-(1H-1,2,4-triazol-1-ylmethyl)benzylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.