CAS 906352-70-3

Tetrahydro-4-(2-iodophenoxy)-2H-pyran

Description:

Tetrahydro-4-(2-iodophenoxy)-2H-pyran is an organic compound characterized by its unique molecular structure, which includes a tetrahydropyran ring and a phenoxy group substituted with an iodine atom. This compound typically exhibits properties associated with both heterocycles and aromatic systems, such as moderate polarity and potential for hydrogen bonding due to the presence of oxygen in the pyran ring. The iodine substitution can influence its reactivity, making it a candidate for various chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the phenoxy group may impart specific biological activities, making it of interest in medicinal chemistry. Its solubility characteristics can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity associated with iodine-containing compounds. Overall, Tetrahydro-4-(2-iodophenoxy)-2H-pyran represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₃IO₂

InChI: InChI=1S/C11H13IO2/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9/h1-4,9H,5-8H2

InChI key: InChIKey=ADTBIBCNKWWYRD-UHFFFAOYSA-N

SMILES: O(C1=C(I)C=CC=C1)C2CCOCC2

Synonyms:

• 2H-Pyran, tetrahydro-4-(2-iodophenoxy)-
• Tetrahydro-4-(2-iodophenoxy)-2H-pyran