CAS 906352-79-2

(6-tetrahydropyran-4-yloxy-3-pyridyl)methanol

Description:

(6-tetrahydropyran-4-yloxy-3-pyridyl)methanol, with the CAS number 906352-79-2, is a chemical compound characterized by its unique structural features that include a tetrahydropyran ring and a pyridine moiety. This compound typically exhibits properties associated with both alcohols and ethers due to the presence of the hydroxymethyl group and the ether linkage. It is likely to be a polar molecule, which can influence its solubility in various solvents, particularly in polar solvents like water and alcohols. The presence of the pyridine ring may impart basicity and potential reactivity, making it of interest in medicinal chemistry and organic synthesis. Additionally, the tetrahydropyran component can contribute to the compound's conformational flexibility, which may affect its biological activity and interactions with other molecules. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological or chemical properties would require further investigation.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1/C11H15NO3/c13-8-9-1-2-11(12-7-9)15-10-3-5-14-6-4-10/h1-2,7,10,13H,3-6,8H2

SMILES: c1cc(ncc1CO)OC1CCOCC1

5-(Hydroxymethyl)-2-(tetrahydro-2H-pyran-4-yloxy)pyridine

CAS: 906352-79-2

5-(Hydroxymethyl)-2-(tetrahydro-2H-pyran-4-yloxy)pyridine

Purity: 97%

Molecular weight: 209.24g/mol

Ref: 54-OR12439

[6-(Oxan-4-yloxy)pyridin-3-yl]methanol

CAS: 906352-79-2

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₃

Purity: Min. 95%

Molecular weight: 209.24 g/mol

Ref: 3D-GLB35279