CAS 906352-82-7
:1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxaldehyde
Description:
1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxaldehyde is an organic compound characterized by its unique structural features, which include a piperidine ring and a pyrazine moiety. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, such as condensation and nucleophilic addition. The methyl group on the pyrazine ring can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the compound's molecular weight and specific functional groups can play a significant role in its pharmacokinetic and pharmacodynamic properties. Overall, 1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxaldehyde represents a versatile structure that can be explored for various applications in chemical synthesis and pharmaceutical research.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-9-6-12-7-11(13-9)14-4-2-10(8-15)3-5-14/h6-8,10H,2-5H2,1H3
InChI key:InChIKey=KWDJDKVUDZLNOD-UHFFFAOYSA-N
SMILES:CC=1N=C(C=NC1)N2CCC(C=O)CC2
Synonyms:- 4-Piperidinecarboxaldehyde, 1-(6-methylpyrazinyl)-
- 4-Piperidinecarboxaldehyde, 1-(6-methyl-2-pyrazinyl)-
- 1-(6-Methylpyrazin-2-yl)piperidine-4-carbaldehyde
- 1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.