CAS 906352-85-0
:3-(1-methylpyrazol-3-yl)benzoic acid
Description:
3-(1-Methylpyrazol-3-yl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a 1-methylpyrazole substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential acidity due to the carboxylic acid group. The presence of the pyrazole ring can impart specific reactivity and biological activity, making it of interest in medicinal chemistry and material science. It is likely to be soluble in polar organic solvents and may exhibit moderate solubility in water, depending on the pH. The compound may also participate in hydrogen bonding due to the carboxylic acid functional group, influencing its interactions in various chemical environments. Additionally, its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-13-6-5-10(12-13)8-3-2-4-9(7-8)11(14)15/h2-7H,1H3,(H,14,15)
SMILES:Cn1ccc(c2cccc(c2)C(=O)O)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid
CAS:3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid
Formula:C11H10N2O2Purity:97%Color and Shape: light brown crystalsMolecular weight:202.21g/mol3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid
CAS:3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid is a chemical compound with the molecular formula C5H5NO2. It is a research chemical that has not yet been fully characterized and its potential uses have not yet been determined. 3-(1-Methyl-1H-pyrazol-3-yl)benzoic acid is used as an intermediate in the synthesis of other compounds, including pharmaceuticals and pesticides. This compound has the potential to be used as a building block for complex compounds, or as a reagent in various reactions.
Formula:C11H10N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:202.21 g/mol3-(3-Carboxyphenyl)-1-methyl-1H-pyrazole
CAS:Controlled ProductFormula:C11H10N2O2Color and Shape:NeatMolecular weight:202.209


