CAS 906352-93-0

4-(2-thienyl)tetrahydropyran-4-carbaldehyde

Description:

4-(2-Thienyl)tetrahydropyran-4-carbaldehyde is an organic compound characterized by its unique structure, which includes a tetrahydropyran ring fused with a thienyl group and an aldehyde functional group. This compound typically exhibits properties associated with both heterocycles and aldehydes, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the thienyl group imparts aromatic characteristics, while the tetrahydropyran ring contributes to its cyclic nature, influencing its reactivity and stability. The aldehyde functional group is reactive, making this compound useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Its potential applications may include serving as an intermediate in the synthesis of more complex molecules or as a building block in the development of pharmaceuticals. Additionally, the compound's solubility and reactivity can vary based on the solvent and conditions used, making it versatile for different chemical reactions.

Formula: C₁₀H₁₂O₂S

InChI: InChI=1/C10H12O2S/c11-8-10(3-5-12-6-4-10)9-2-1-7-13-9/h1-2,7-8H,3-6H2

SMILES: c1cc(C2(CCOCC2)C=O)sc1

4-Thien-2-yltetrahydro-2H-pyran-4-carboxaldehyde

CAS: 906352-93-0

4-Thien-2-yltetrahydro-2H-pyran-4-carboxaldehyde

Purity: 90%

Color and Shape: Off-White Low-Melting Solid

Molecular weight: 196.27g/mol

Ref: 54-OR14932