CAS 906352-94-1

[4-(2-thienyl)tetrahydropyran-4-yl]methanol

Description:

[4-(2-Thienyl)tetrahydropyran-4-yl]methanol, with the CAS number 906352-94-1, is a chemical compound characterized by its unique structure that includes a tetrahydropyran ring substituted with a thienyl group and a hydroxymethyl group. This compound typically exhibits properties associated with both the tetrahydropyran and thienyl moieties, such as potential solubility in organic solvents and moderate polarity due to the presence of the hydroxymethyl group. The thienyl group may impart aromatic characteristics, influencing the compound's reactivity and interaction with other chemical species. Additionally, the presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can affect its physical properties, such as boiling and melting points. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could lead to interesting biological activities or applications in synthesis. However, specific data regarding its reactivity, stability, and biological properties would require further investigation and empirical studies.

Formula: C₁₀H₁₄O₂S

InChI: InChI=1/C10H14O2S/c11-8-10(3-5-12-6-4-10)9-2-1-7-13-9/h1-2,7,11H,3-6,8H2

SMILES: c1cc(C2(CCOCC2)CO)sc1

4-(Hydroxymethyl)-4-(thien-2-yl)tetrahydro-2H-pyran

CAS: 906352-94-1

4-(Hydroxymethyl)-4-(thien-2-yl)tetrahydro-2H-pyran

Purity: ≥95%

Molecular weight: 198.28g/mol

Ref: 54-OR14941