
CAS 906371-82-2
:2-Chloro-N-cyclopentyl-3-pyridinamine
Description:
2-Chloro-N-cyclopentyl-3-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom and a cyclopentyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyridine and cyclopentyl moieties. It is likely to be a solid at room temperature, with moderate solubility in polar organic solvents, reflecting the influence of the polar pyridine nitrogen and the non-polar cyclopentyl group. The chlorine substituent can impart specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H13ClN2
InChI:InChI=1S/C10H13ClN2/c11-10-9(6-3-7-12-10)13-8-4-1-2-5-8/h3,6-8,13H,1-2,4-5H2
InChI key:InChIKey=XNUCAUDPHYSKAN-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)N=CC=C1)C2CCCC2
Synonyms:- 3-Pyridinamine, 2-chloro-N-cyclopentyl-
- (2-Chloropyridin-3-yl)cyclopentylamine
- 2-Chloro-N-cyclopentyl-3-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
