CAS 90642-84-5
:4-(4-hydroxybutyl)pyridinium chloride
Description:
4-(4-Hydroxybutyl)pyridinium chloride is a quaternary ammonium compound characterized by its pyridinium ring and a hydroxybutyl side chain. This compound typically appears as a white to off-white solid or crystalline powder. It is soluble in water and polar organic solvents, which is indicative of its ionic nature due to the presence of the quaternary ammonium group. The hydroxybutyl moiety contributes to its hydrophilicity and may enhance its biological activity. This substance is often studied for its potential applications in pharmaceuticals, surfactants, and as a biocide due to its antimicrobial properties. Its structure allows for interactions with biological membranes, making it of interest in drug delivery systems. Additionally, the presence of the hydroxyl group can facilitate hydrogen bonding, influencing its reactivity and interactions in various chemical environments. Safety data should be consulted for handling, as quaternary ammonium compounds can exhibit toxicity and irritant properties.
Formula:C9H14ClNO
InChI:InChI=1/C9H13NO.ClH/c11-8-2-1-3-9-4-6-10-7-5-9;/h4-7,11H,1-3,8H2;1H
SMILES:C(CCO)Cc1ccncc1.Cl
Synonyms:- 4-(Pyridin-4-yl)butan-1-ol hydrochloride (1:1)
- 4-Pyridinebutanol, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
