
CAS 90643-46-2
:3,4,5-Trimethylbenzenesulfonamide
Description:
3,4,5-Trimethylbenzenesulfonamide, with the CAS number 90643-46-2, is an organic compound characterized by the presence of a sulfonamide functional group attached to a trimethyl-substituted benzene ring. This compound features three methyl groups located at the 3, 4, and 5 positions of the benzene ring, which contributes to its hydrophobic nature and influences its solubility and reactivity. The sulfonamide group (-SO2NH2) is known for its ability to form hydrogen bonds, which can enhance the compound's interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit properties such as moderate stability under standard conditions, and its melting and boiling points can vary based on the molecular structure and intermolecular forces. Additionally, 3,4,5-trimethylbenzenesulfonamide may be utilized in various applications, including as a reagent in organic synthesis or as a potential pharmaceutical intermediate. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C9H13NO2S
InChI:InChI=1S/C9H13NO2S/c1-6-4-9(13(10,11)12)5-7(2)8(6)3/h4-5H,1-3H3,(H2,10,11,12)
InChI key:InChIKey=QAPSKAGDPNFSLO-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(C)=C(C)C(C)=C1
Synonyms:- Benzenesulfonamide, 3,4,5-trimethyl-
- 3,4,5-Trimethylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.