CAS 90645-55-9
:α,α-Dimethyl-3-cyclohexene-1-methanol
Description:
α,α-Dimethyl-3-cyclohexene-1-methanol is an organic compound characterized by its cyclohexene structure, which features a double bond and a hydroxyl (-OH) functional group. This compound is a colorless to pale yellow liquid at room temperature and is known for its pleasant, floral odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic cyclohexene ring. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as dehydration and esterification. Additionally, α,α-Dimethyl-3-cyclohexene-1-methanol can serve as a precursor in the synthesis of more complex organic molecules and may have applications in the fragrance and flavor industry. Its chemical stability and relatively low volatility make it suitable for various formulations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H16O
InChI:InChI=1/C9H16O/c1-9(2,10)8-6-4-3-5-7-8/h3-4,8,10H,5-7H2,1-2H3
InChI key:InChIKey=FGCVUJGUQUFWLT-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C1CCC=CC1
Synonyms:- α,α-Dimethyl-3-cyclohexene-1-methanol
- 2-Cyclohex-3-en-1-ylpropan-2-ol
- 2-(Cyclohex-3-en-1-yl)propan-2-ol
- 2-(cyclohex-3-en-1-yl)propan-2-ol
- 3-Cyclohexene-1-methanol, α,α-dimethyl-
- alpha,alpha-Dimethylcyclohex-3-ene-1-methanol
- 2-(3-Cyclohexenyl)-2-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.