CAS 906477-25-6

[2-(2-fluorophenyl)-1H-imidazol-5-yl]methanol

Description:

[2-(2-fluorophenyl)-1H-imidazol-5-yl]methanol, with the CAS number 906477-25-6, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, contributing to the compound's unique electronic properties and potential biological activity. The hydroxymethyl group (-CH2OH) attached to the imidazole ring enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₀H₉FN₂O

InChI: InChI=1/C10H9FN2O/c11-9-4-2-1-3-8(9)10-12-5-7(6-14)13-10/h1-5,14H,6H2,(H,12,13)

Synonyms:

• [2-(2-Fluorophenyl)-1H-imidazol-5-yl]methanol
• 1H-Imidazole-5-methanol, 2-(2-fluorophenyl)-

2-(2-FLUOROPHENYL)-1H-IMIDAZOL-5-YL]METHANOL

CAS: 906477-25-6

Formula: C₁₀H₉FN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 192.1897

Ref: IN-DA006BTG

(2-(2-Fluorophenyl)-1H-imidazol-5-yl)methanol

CAS: 906477-25-6

Purity: ≥95%

Molecular weight: 192.1929932

Ref: 10-F897476