CAS 90649-78-8
:4-Chloro-3,5-dimethylbenzoic acid
Description:
4-Chloro-3,5-dimethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a chlorine atom and two methyl groups. The chlorine atom is located at the para position relative to the carboxylic acid group, while the methyl groups are positioned at the meta positions. This compound typically appears as a white to off-white crystalline solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the chlorine and methyl substituents can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its molecular structure contributes to its potential applications in organic synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=ZHHGJCFPDAJYTF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C)=C(Cl)C(C)=C1
Synonyms:- Benzoic acid, 4-chloro-3,5-dimethyl-
- 4-Chloro-3,5-dimethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 4-chloro-3,5-dimethyl-
CAS:Formula:C9H9ClO2Purity:99%Color and Shape:SolidMolecular weight:184.61964-Chloro-3,5-Dimethylbenzoic Acid
CAS:4-Chloro-3,5-Dimethylbenzoic AcidPurity:99%Molecular weight:184.62g/mol4-Chloro-3,5-dimethylbenzoic acid
CAS:4-Chloro-3,5-dimethylbenzoic acid (4CMB) is a building block in organic chemistry. It can be used as a reagent, speciality chemical, and research chemical. 4CMB is used to make an intermediate for the synthesis of other chemicals and it can also be used as a reaction component in more complex reactions. CAS No. 90649-78-8
Formula:C9H9ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:184.62 g/mol4-Chloro-3,5-dimethylbenzoic acid
CAS:Formula:C9H9ClO2Purity:99%(LC-MS);RGColor and Shape:SolidMolecular weight:184.62



