CAS 90649-82-4

[(4-chlorobenzyl)sulfanyl]acetate

Description:

[(4-Chlorobenzyl)sulfanyl]acetate, with the CAS number 90649-82-4, is an organic compound characterized by the presence of a sulfanyl (thioether) functional group attached to a 4-chlorobenzyl moiety and an acetate group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the chlorobenzyl group imparts certain reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its sulfanyl group can also participate in further chemical transformations, making it useful in synthetic organic chemistry. Safety data should be consulted, as compounds containing halogens and sulfur can exhibit toxicity or environmental hazards. Overall, [(4-chlorobenzyl)sulfanyl]acetate is of interest in both academic research and industrial applications, particularly in the synthesis of pharmaceuticals and agrochemicals.

Formula: C₉H₉ClO₂S

InChI: InChI=1/C9H9ClO2S/c10-8-3-1-7(2-4-8)5-13-6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1CSCC(=O)O)Cl

Synonyms:

• Acetic Acid, 2-[[(4-Chlorophenyl)Methyl]Thio]-

[(4-Chlorobenzyl)thio]acetic acid

CAS: 90649-82-4

[(4-Chlorobenzyl)thio]acetic acid

Purity: ≥95%

Molecular weight: 216.69g/mol

Ref: 54-OR97924

[(4-chlorobenzyl)thio]acetic acid

CAS: 90649-82-4

Formula: C₉H₉ClO₂S

Molecular weight: 216.68

Ref: 10-F346795