CymitQuimica logo

CAS 90655-78-0

:

2-[(2-Propen-1-yloxy)methyl]-1,4,7,10-tetraoxacyclododecane

Description:
2-[(2-Propen-1-yloxy)methyl]-1,4,7,10-tetraoxacyclododecane, with CAS number 90655-78-0, is a chemical compound characterized by its unique structure that includes a tetraoxacyclododecane ring, which is a cyclic ether containing four oxygen atoms. This compound features a propenyl ether functional group, contributing to its reactivity and potential applications in polymer chemistry and materials science. The presence of multiple ether linkages in its structure imparts properties such as flexibility and solubility in various organic solvents. Additionally, the propenyl group can undergo further chemical reactions, such as polymerization, making this compound useful in the synthesis of more complex materials. Its molecular structure suggests potential applications in fields like drug delivery, coatings, and adhesives, where the combination of flexibility and reactivity is advantageous. However, specific safety and handling guidelines should be followed, as with all chemical substances, to ensure safe usage in laboratory and industrial settings.
Formula:C12H22O5
InChI:InChI=1S/C12H22O5/c1-2-3-15-10-12-11-16-7-6-13-4-5-14-8-9-17-12/h2,12H,1,3-11H2
InChI key:InChIKey=QURYXQDATAUISH-UHFFFAOYSA-N
SMILES:C(OCC=C)C1COCCOCCOCCO1
Synonyms:
  • 1,4,7,10-Tetraoxacyclododecane, 2-[(2-propen-1-yloxy)methyl]-
  • (Allyloxy)methyl-12-crown-4
  • 1,4,7,10-Tetraoxacyclododecane, 2-[(2-propenyloxy)methyl]-
  • 2-[(2-Propen-1-yloxy)methyl]-1,4,7,10-tetraoxacyclododecane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.