CAS 906559-47-5

5-Chloro-4-fluoro-2-nitrobenzonitrile

Description:

5-Chloro-4-fluoro-2-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group, a fluoro group, and a nitro group, along with a nitrile functional group. The presence of these substituents contributes to its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogen and nitro groups, which can influence solubility in various solvents. The nitrile group (-C≡N) is known for its ability to participate in nucleophilic reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Its molecular structure suggests that it may have specific interactions with biological targets, although detailed studies would be necessary to elucidate its biological properties. Overall, 5-Chloro-4-fluoro-2-nitrobenzonitrile is a versatile compound with potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₇H₂ClFN₂O₂

InChI: InChI=1S/C7H2ClFN2O2/c8-5-1-4(3-10)7(11(12)13)2-6(5)9/h1-2H

InChI key: InChIKey=JSGFLJIYPLSJRD-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C#N)C=C(Cl)C(F)=C1

Synonyms:

• Benzonitrile, 5-chloro-4-fluoro-2-nitro-
• 5-Chloro-4-fluoro-2-nitrobenzonitrile