CAS 90657-55-9
:L-Proline, 4-cyclohexyl-, hydrochloride (1:1), (4S)-
Description:
L-Proline, 4-cyclohexyl-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its structure as a derivative of proline, an amino acid. This substance features a cyclohexyl group attached to the proline backbone, which influences its physical and chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and biochemistry. The (4S) designation indicates the specific stereochemistry of the proline molecule, which is crucial for its biological activity and interactions. L-Proline is known for its role in protein synthesis and as a building block for peptides. The presence of the cyclohexyl group may impart unique steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. Overall, this compound is of interest in research and development, particularly in the fields of medicinal chemistry and materials science.
Formula:C11H19NO2·ClH
InChI:InChI=1S/C11H19NO2.ClH/c13-11(14)10-6-9(7-12-10)8-4-2-1-3-5-8;/h8-10,12H,1-7H2,(H,13,14);1H/t9-,10+;/m1./s1
InChI key:InChIKey=BHGFUQJUTOVQOS-UXQCFNEQSA-N
SMILES:C(O)(=O)[C@@H]1C[C@H](CN1)[C@@H]2CCCCC2.Cl
Synonyms:- <span class="text-smallcaps">L</span>-Proline, 4-cyclohexyl-, hydrochloride (1:1), (4S)-
- <span class="text-smallcaps">L</span>-Proline, 4-cyclohexyl-, hydrochloride, (4S)-
- <span class="text-smallcaps">L</span>-Proline, 4-cyclohexyl-, hydrochloride, trans-
- trans-4-Cyclohexyl-<span class="text-smallcaps">L</span>-proline hydrochloride
- trans-4-Cyclohexyl-L-Proline hydrochloride
- L-Proline, 4-cyclohexyl-, hydrochloride (1:1), (4S)-
- L-Proline, 4-cyclohexyl-, hydrochloride, (4S)-
- L-Proline, 4-cyclohexyl-, hydrochloride, trans-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Trans-4-cyclohexyl-l-proline, HCl
CAS:Formula:C11H20ClNO2Purity:97%Color and Shape:SolidMolecular weight:233.7350Fosinopril Impurity 7 HCl
CAS:Formula:C11H19NO2·HClColor and Shape:White To Off-White SolidMolecular weight:197.28 36.46(4S)-4-Cyclohexyl-L-proline hydrochloride
CAS:Formula:C11H19NO2·ClHColor and Shape:NeatMolecular weight:233.74(4S)-4-Cyclohexyl-L-proline hydrochloride 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C11H19NO2·ClHColor and Shape:Single SolutionMolecular weight:233.74(4S)-4-Cyclohexyl-L-proline Hydrochloride
CAS:Controlled ProductApplications It is an intermediate for the synthesis of angiotensin-converting enzyme inhibitors, e.g. Fosinopril (F727800).
References Renaud, P., et al.: Helv. Chim. Acta, 69, 1704 (1986), Thaisrivongs, S., et al.: J. Med. Chem., 31, 1369 (1988),Formula:C11H19NO2·ClHColor and Shape:White To Off-WhiteMolecular weight:233.74trans-4-Cyclohexyl-L-proline hydrochloride
CAS:Formula:C11H20ClNO2Purity:97%Color and Shape:SolidMolecular weight:233.74





