CymitQuimica logo

CAS 90662-12-7

:

4,6-dichloro-2-(methylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidine

Description:
4,6-Dichloro-2-(methylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex ring structure, which incorporates both pyrrole and pyrimidine moieties. This compound features two chlorine atoms at the 4 and 6 positions, contributing to its reactivity and potential biological activity. The presence of a methylsulfanyl group at the 2 position enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly as pharmaceuticals or agrochemicals, due to their ability to interact with biological targets. The molecular structure suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine and methylsulfanyl groups, making it a subject of interest in synthetic organic chemistry and drug development.
Formula:C7H5Cl2N3S
InChI:InChI=1/C7H5Cl2N3S/c1-13-7-11-5(9)3-2-4(8)10-6(3)12-7/h2H,1H3,(H,10,11,12)
SMILES:CSc1nc(c2cc(Cl)[nH]c2n1)Cl
Synonyms:
  • 7H-pyrrolo[2,3-d]pyrimidine, 4,6-dichloro-2-(methylthio)-
  • 4,6-Dichloro-2-(methylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.