CymitQuimica logo

CAS 906745-82-2

:

Isoquinoline, 1-(1-piperazinyl)-, hydrochloride (1:2)

Description:
Isoquinoline, 1-(1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of a piperazine moiety enhances its pharmacological properties, making it of interest in medicinal chemistry, particularly for its potential biological activities. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including drug formulation. The compound may exhibit properties such as basicity due to the piperazine nitrogen atoms, and it can participate in hydrogen bonding, influencing its interaction with biological targets. Its molecular structure suggests potential applications in the development of pharmaceuticals, particularly in the treatment of neurological disorders or as an antipsychotic agent. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies. Overall, this compound represents a significant area of interest in the field of organic and medicinal chemistry.
Formula:C13H15N3·2ClH
InChI:InChI=1S/C13H15N3.2ClH/c1-2-4-12-11(3-1)5-6-15-13(12)16-9-7-14-8-10-16;;/h1-6,14H,7-10H2;2*1H
InChI key:InChIKey=CZWNYSDNFITLRT-UHFFFAOYSA-N
SMILES:C=1(C2=C(C=CN1)C=CC=C2)N3CCNCC3.Cl
Synonyms:
  • Isoquinoline, 1-(1-piperazinyl)-, hydrochloride (1:2)
  • Isoquinoline, 1-(1-piperazinyl)-, dihydrochloride
  • 1-(Piperazin-1-yl)isoquinoline dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.