CAS 90679-35-9
:5-(4-pyridyl)-1H-indole
Description:
5-(4-Pyridyl)-1H-indole, with the CAS number 90679-35-9, is an organic compound characterized by its indole core, which is fused to a pyridine ring. This compound exhibits a heterocyclic structure, combining the properties of both indole and pyridine, making it of interest in various fields such as medicinal chemistry and material science. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry and its ability to participate in hydrogen bonding due to the nitrogen atom in the pyridine ring. Additionally, the compound may exhibit biological activity, which has led to research into its potential applications in pharmaceuticals. Its unique structure allows for various functionalizations, making it a versatile building block in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H10N2
InChI:InChI=1/C13H10N2/c1-2-13-12(5-8-15-13)9-11(1)10-3-6-14-7-4-10/h1-9,15H
SMILES:c1cc2c(cc[nH]2)cc1c1ccncc1
Synonyms:- 1H-indole, 5-(4-pyridinyl)-
- 5-(Pyridin-4-yl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
