CAS 90685-01-1
:3-(1-Piperazinyl)-9H-dibenzo[c,f]-1,2,4-triazolo[4,3-a]azepine
Description:
3-(1-Piperazinyl)-9H-dibenzo[c,f]-1,2,4-triazolo[4,3-a]azepine is a chemical compound characterized by its complex structure, which includes a dibenzo fused triazole and azepine moiety. This compound features a piperazine ring, which is known for its pharmacological properties, often contributing to the biological activity of the molecule. The presence of the triazole ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as triazoles are commonly found in various therapeutic agents. The compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological activities would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry. As with many complex organic compounds, understanding its characteristics requires comprehensive analysis through techniques such as spectroscopy and chromatography.
Formula:C19H19N5
InChI:InChI=1/C19H19N5/c1-3-7-16-14(5-1)13-15-6-2-4-8-17(15)24-18(16)21-22-19(24)23-11-9-20-10-12-23/h1-8,20H,9-13H2
InChI key:InChIKey=GXFWOMYQHNODFA-UHFFFAOYSA-N
SMILES:N12C(C=3C(CC=4C1=CC=CC4)=CC=CC3)=NN=C2N5CCNCC5
Synonyms:- Pitrazepin
- 3-(1-Piperazinyl)-9H-dibenzo[c,f]-1,2,4-triazolo[4,3-a]azepine
- 9H-Dibenzo[c,f]-1,2,4-triazolo[4,3-a]azepine, 3-(1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pitrazepin
CAS:Pitrazepin is a new GABAA receptor antagonist reported to antagonize electrophysiological effects of GABAFormula:C19H19N5Color and Shape:SolidMolecular weight:317.39
