CAS 90706-10-8

4-(D-Apio-β-D-furanosyloxy)-9-(1,3-benzodioxol-5-yl)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one

Description:

4-(D-Apio-β-D-furanosyloxy)-9-(1,3-benzodioxol-5-yl)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one, with CAS number 90706-10-8, is a complex organic compound characterized by its unique structural features, including a naphthoquinone core fused with a furan and benzodioxole moiety. This compound exhibits a range of functional groups, such as methoxy and glycosyl moieties, which contribute to its potential biological activity. It is likely to possess antioxidant properties due to the presence of the benzodioxole structure, which is known for its ability to scavenge free radicals. Additionally, the glycosylation may enhance its solubility and bioavailability, making it of interest in pharmacological studies. The compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its specific biological activities, mechanisms of action, and potential therapeutic uses would be necessary to fully understand its characteristics and applications in the field of chemistry and pharmacology.

Formula: C₂₆H₂₄O₁₁

InChI: InChI=1S/C26H24O11/c1-31-17-6-13-14(7-18(17)32-2)22(37-25-23(28)26(30,9-27)10-34-25)15-8-33-24(29)21(15)20(13)12-3-4-16-19(5-12)36-11-35-16/h3-7,23,25,27-28,30H,8-11H2,1-2H3/t23-,25-,26+/m0/s1

InChI key: InChIKey=XIARCTMJGANPJU-AYRHNUGRSA-N

SMILES: O=C1C2=C(C=3C(C(O[C@H]4[C@H](O)[C@](CO)(O)CO4)=C2CO1)=CC(OC)=C(OC)C3)C=5C=C6C(=CC5)OCO6

Synonyms:

• Naphtho[2,3-c]furan-1(3H)-one, 4-(D-apio-β-D-furanosyloxy)-9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-
• Tuberculatin
• 4-(D-Apio-β-D-furanosyloxy)-9-(1,3-benzodioxol-5-yl)-6,7-dimethoxynaphtho[2,3-c]furan-1(3H)-one

Naphtho[2,3-c]furan-1(3H)-one, 4-(D-apio-β-D-furanosyloxy)-9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-

CAS: 90706-10-8

Formula: C₂₆H₂₄O₁₁

Purity: 98.0%

Molecular weight: 512.4622

Ref: IN-DA01Q7WE

Tuberculatin

CAS: 90706-10-8

Tuberculatin is a diagnostic reagent, which is derived from a purified protein derivative of Mycobacterium tuberculosis. Its mode of action involves eliciting a hypersensitivity reaction when injected intradermally into individuals previously exposed to tuberculosis antigens. This reaction is utilized in tuberculin skin testing, specifically the Mantoux test, to assess an individual's exposure to the tuberculosis bacterium.

Formula: C₂₆H₂₄O₁₁

Purity: Min. 95%

Molecular weight: 512.5 g/mol

Ref: 3D-QDA70610