CAS 907208-90-6
:1-(5-Fluoropyridin-2-yl)piperazine
Description:
1-(5-Fluoropyridin-2-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 5-fluoropyridine substituent at one of the piperazine's nitrogen positions contributes to its unique properties. This compound typically exhibits moderate to high solubility in polar solvents due to the presence of the nitrogen atoms and the polar nature of the pyridine ring. It is often studied for its potential biological activities, particularly in medicinal chemistry, where it may serve as a scaffold for developing pharmaceuticals targeting various receptors or enzymes. The fluorine atom can influence the compound's lipophilicity and metabolic stability, making it a valuable modification in drug design. Additionally, 1-(5-Fluoropyridin-2-yl)piperazine may exhibit specific interactions with biological targets, which can be explored through structure-activity relationship studies. Overall, this compound represents a versatile building block in the synthesis of more complex molecules in the field of organic and medicinal chemistry.
Formula:C9H12FN3
InChI:InChI=1S/C9H12FN3/c10-8-1-2-9(12-7-8)13-5-3-11-4-6-13/h1-2,7,11H,3-6H2
InChI key:InChIKey=DTAOJTXARNSWRJ-UHFFFAOYSA-N
SMILES:FC1=CC=C(N=C1)N2CCNCC2
Synonyms:- 1-(5-Fluoro-2-pyridinyl)piperazine
- 1-(5-Fluoropyridin-2-yl)piperazine
- Piperazine, 1-(5-fluoro-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
