CAS 90721-27-0

5-Benzofurancarboxylic acid

Description:

5-Benzofurancarboxylic acid is an organic compound characterized by its fused benzofuran and carboxylic acid functional groups. It typically appears as a white to off-white solid and is soluble in organic solvents, though its solubility in water is limited. The compound features a benzofuran ring, which contributes to its aromatic properties, and a carboxylic acid group that imparts acidic characteristics. This substance is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities and applications in the development of pharmaceuticals. The presence of the carboxylic acid group allows for further functionalization, making it a versatile intermediate in chemical reactions. Additionally, its structural features may influence its reactivity and interaction with biological systems, warranting further investigation into its properties and potential uses. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₆O₃

InChI: InChI=1S/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11)

InChI key: InChIKey=GTWXSZIQNTUNKR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CC1)OC=C2

Synonyms:

• 5-Benzofurancarboxylic acid
• Benzo[b]furan-5-carboxylic acid
• 1-Benzofuran-5-carboxylic acid

Benzofuran-5-carboxylic acid

CAS: 90721-27-0

Formula: C₉H₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.1421

Ref: IN-DA003DZ0

Benzo[b]furan-5-carboxylic acid

CAS: 90721-27-0

Benzo[b]furan-5-carboxylic acid

Purity: 96%

Color and Shape: Off-White Solid

Molecular weight: 162.14g/mol

Ref: 54-OR23098

Benzofuran-5-carboxylic acid

CAS: 90721-27-0

Formula: C₉H₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.144

Ref: 10-F221611