CymitQuimica logo

CAS 90721-60-1

:

5-chloro-6-methoxy-1H-indole

Description:
5-Chloro-6-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent's polarity. It is often used in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anticancer properties. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methoxy group may enhance its lipophilicity. As with many indole derivatives, 5-chloro-6-methoxy-1H-indole may also participate in various chemical reactions, such as electrophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H8ClNO
InChI:InChI=1/C9H8ClNO/c1-12-9-5-8-6(2-3-11-8)4-7(9)10/h2-5,11H,1H3
InChI key:YZOVTJRDGFRPRI-UHFFFAOYSA-N
SMILES:COc1cc2c(cc[nH]2)cc1Cl
Synonyms:
  • 1H-indole, 5-chloro-6-methoxy-
  • 5-Chloro-6-methoxy-1H-indole
Found 4 products.