CAS 90723-13-0

N-methyl-N,N'-bis(1-methylethyl)ethane-1,2-diamine

Description:

N-methyl-N,N'-bis(1-methylethyl)ethane-1,2-diamine, with the CAS number 90723-13-0, is an organic compound characterized by its amine functional groups. It features a central ethane backbone with two alkyl substituents, specifically isopropyl groups, and a methyl group attached to the nitrogen atoms. This structure contributes to its properties as a tertiary amine, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The presence of multiple alkyl groups enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Additionally, the compound may exhibit basicity due to the availability of lone pairs on the nitrogen atoms, allowing it to act as a proton acceptor. Its applications may include use as a ligand in coordination chemistry, a building block in organic synthesis, or as a potential intermediate in the production of more complex chemical entities. Safety data should be consulted for handling and storage, as amines can be hazardous.

Formula: C₉H₂₂N₂

InChI: InChI=1/C9H22N2/c1-8(2)10-6-7-11(5)9(3)4/h8-10H,6-7H2,1-5H3