CymitQuimica logo

CAS 90724-46-2

:

Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyltin

Description:
Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyltin, with CAS number 90724-46-2, is an organotin compound characterized by its complex structure, which includes a phenyl group and three tridecafluorooctyl substituents. This compound is notable for its high degree of fluorination, which imparts unique properties such as hydrophobicity and lipophobicity, making it useful in various applications, including as a surface modifier and in coatings. Organotin compounds are known for their biocidal properties, although their environmental persistence and potential toxicity raise concerns regarding their use. The presence of multiple fluorinated chains enhances the compound's stability and resistance to degradation. Additionally, the compound's molecular structure contributes to its potential applications in advanced materials and nanotechnology. However, due to regulatory scrutiny surrounding organotin compounds, their use may be restricted in certain applications, necessitating careful consideration of environmental and health impacts.
Formula:C6H8ClNO
InChI:InChI=1/C6H7NO.ClH/c1-5-6(8)3-2-4-7-5;/h2-4,8H,1H3;1H
SMILES:Cc1c(cccn1)O.Cl
Synonyms:
  • N-Methylsulfonyl-tyramine
  • 2-Methyl-3-pyridinol hydrochloride
  • 2-Methylpyridin-3-Ol Hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.