CAS 90724-57-5

3-Methyl-1H-pyrrole-2-carboxylic acid

Description:

3-Methyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl group at the 3-position and a carboxylic acid functional group at the 2-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The presence of the carboxylic acid group makes it acidic, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the methyl group can influence the compound's solubility and stability. 3-Methyl-1H-pyrrole-2-carboxylic acid may be used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structural features. Its CAS number, 90724-57-5, is a unique identifier that facilitates the tracking and regulation of this substance in chemical databases and regulatory frameworks.

Formula: C₆H₇NO₂

InChI: InChI=1/C6H7NO2/c1-4-2-3-7-5(4)6(8)9/h2-3,7H,1H3,(H,8,9)

SMILES: Cc1cc[nH]c1C(=O)O

Synonyms:

• 1H-pyrrole-2-carboxylic acid, 3-methyl-
• 3-Methyl-1H-pyrrole-2-carboxylicacid

3-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 90724-57-5

Formula: C₆H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.1253

Ref: IN-DA006AW5

3-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 90724-57-5

3-Methyl-1H-pyrrole-2-carboxylic acid

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR313040

3-Methyl-1H-pyrrole-2-carboxylic acid

CAS: 90724-57-5

Formula: C₆H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.127

Ref: 10-F092918