CAS 90734-55-7
:4-tert-Butylphenoxyacetyl chloride
Description:
4-tert-Butylphenoxyacetyl chloride, with the CAS number 90734-55-7, is an organic compound characterized by its functional groups, including an acyl chloride and a phenoxy group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can readily undergo nucleophilic substitution reactions. It is often used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The tert-butyl group contributes to its steric bulk, influencing its reactivity and solubility properties. Additionally, this compound may exhibit moderate toxicity, necessitating appropriate safety precautions during handling and use. Its stability can be affected by moisture, as acyl chlorides are generally sensitive to hydrolysis, leading to the formation of corresponding acids. Overall, 4-tert-Butylphenoxyacetyl chloride is a valuable reagent in synthetic organic chemistry, with applications that leverage its unique chemical properties.
Formula:C12H15ClO2
InChI:InChI=1/C12H15ClO2/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7H,8H2,1-3H3
SMILES:CC(C)(C)c1ccc(cc1)OCC(=O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-tert-Butylphenoxyacetyl chloride, 98%
CAS:4-tert-Butylphenoxyacetyl chloride is used as a reagent and as intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or
Formula:C12H15O2ClPurity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:226.714-tert-Butylphenoxyacetyl chloride
CAS:Formula:C12H15ClO2Purity:98%Color and Shape:LiquidMolecular weight:226.69932-(4-(Tert-Butyl)Phenoxy)Acetyl Chloride
CAS:2-(4-(Tert-Butyl)Phenoxy)Acetyl ChloridePurity:98%Molecular weight:226.70g/mol



