CAS 9074-77-5
:Fluoroacetic acid
Description:
Fluoroacetic acid is a colorless, odorless liquid that is a derivative of acetic acid, where one of the hydrogen atoms is replaced by a fluorine atom. Its chemical formula is C2H3F O2, and it is classified as a halogenated carboxylic acid. This compound is known for its high toxicity, as it can interfere with cellular metabolism by inhibiting the enzyme aconitase, leading to disruptions in the citric acid cycle. Fluoroacetic acid is soluble in water and organic solvents, making it versatile in various chemical applications. It is used in the synthesis of pharmaceuticals and agrochemicals, but due to its toxic nature, it must be handled with extreme care. The substance has a relatively low boiling point and can form stable salts with bases. Additionally, it is important to note that fluoroacetic acid can be a hazardous material, and its use is regulated in many jurisdictions due to its potential environmental and health impacts.
Formula:C2H3FO2
InChI:InChI=1S/C2H3FO2/c3-1-2(4)5/h1H2,(H,4,5)
InChI key:InChIKey=QEWYKACRFQMRMB-UHFFFAOYSA-N
SMILES:C(CF)(O)=O
Synonyms:- Fluoroacetic acid
- Acetic acid, fluoro-
- Cymonic acid
- 2-Fluoroacetic acid
- Acetic acid, 2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.