CAS 90747-55-0
:3-(1H-imidazol-2-yl)piperidine
Description:
3-(1H-imidazol-2-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and an imidazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the imidazole is a five-membered ring containing two nitrogen atoms. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may serve as a scaffold for developing pharmaceuticals. Its properties include being a polar molecule, which can influence its solubility and interaction with biological targets. The presence of both nitrogen-containing rings suggests potential for hydrogen bonding and interaction with various receptors or enzymes. Additionally, the compound may exhibit basicity due to the nitrogen atoms, which can affect its reactivity and stability in different environments. Overall, 3-(1H-imidazol-2-yl)piperidine is of interest in research fields such as drug design and development, particularly for its potential therapeutic applications.
Formula:C8H13N3
InChI:InChI=1/C8H13N3/c1-2-7(6-9-3-1)8-10-4-5-11-8/h4-5,7,9H,1-3,6H2,(H,10,11)
SMILES:C1CC(CNC1)c1ncc[nH]1
Synonyms:- piperidine, 3-(1H-imidazol-2-yl)-
- 3-(1H-Imidazol-2-yl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
