CAS 90747-65-2

4-(1H-Imidazol-2-ylmethyl)piperidine

Description:

4-(1H-Imidazol-2-ylmethyl)piperidine, identified by its CAS number 90747-65-2, is a chemical compound characterized by its unique structure that combines a piperidine ring with an imidazole moiety. This compound typically exhibits properties such as being a colorless to pale yellow solid or liquid, depending on its form and purity. It is soluble in polar solvents like water and alcohols, which is indicative of its potential for hydrogen bonding due to the presence of nitrogen atoms in both the piperidine and imidazole rings. The imidazole group contributes to its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit basic properties due to the nitrogen atoms, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its structural features suggest potential applications in drug design, particularly in targeting specific biological pathways or receptors. As with many organic compounds, safety data should be consulted for handling and usage guidelines.

Formula: C₉H₁₅N₃

InChI: InChI=1S/C9H15N3/c1-3-10-4-2-8(1)7-9-11-5-6-12-9/h5-6,8,10H,1-4,7H2,(H,11,12)

InChI key: InChIKey=LNPROGAMXALBAN-UHFFFAOYSA-N

SMILES: C(C1CCNCC1)C=2NC=CN2

Synonyms:

• 4-(1H-Imidazol-2-ylmethyl)piperidine
• Piperidine, 4-(1H-imidazol-2-ylmethyl)-
• 4-[(1H-Imidazol-2-yl)methyl]piperidine