CAS 907545-47-5

2-chloro-5-nitro-pyridine-4-carboxylic acid

Description:

2-Chloro-5-nitro-pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, a nitro group, and a carboxylic acid functional group. The presence of these substituents contributes to its unique chemical properties, including increased acidity due to the carboxylic acid group and potential reactivity due to the electrophilic nature of the nitro group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, influenced by the carboxylic acid functionality. Its structure allows for various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry and pharmaceutical applications. Additionally, the chlorine and nitro groups can enhance the compound's biological activity, potentially making it useful in agrochemical or medicinal chemistry contexts. Safety data should be consulted, as halogenated and nitro compounds can pose health and environmental risks.

Formula: C₆H₃ClN₂O₄

InChI: InChI=1/C6H3ClN2O4/c7-5-1-3(6(10)11)4(2-8-5)9(12)13/h1-2H,(H,10,11)

SMILES: c1c(c(cnc1Cl)N(=O)=O)C(=O)O

Synonyms:

• 2-Chloro-5-nitro isonicotinic acid

2-Chloro-5-Nitro Isonicotinic Acid

CAS: 907545-47-5

Formula: C₆H₃ClN₂O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 202.5520

Ref: IN-DA00H11H

2-Chloro-5-nitroisonicotinic acid

CAS: 907545-47-5

2-Chloro-5-nitroisonicotinic acid

Formula: C₆H₃ClN₂O₄

Purity: 97%

Color and Shape: white crystalline powder

Molecular weight: 202.55g/mol

Ref: 54-OR303997

2-Chloro-5-nitroisonicotinic acid

CAS: 907545-47-5

Formula: C₆H₃ClN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.55

Ref: 10-F210498