CymitQuimica logo

CAS 907552-39-0

:

5-amino-2-(trifluoromethyl)-1,3-oxazole-4-carbonitrile

Description:
5-Amino-2-(trifluoromethyl)-1,3-oxazole-4-carbonitrile is a heterocyclic organic compound characterized by the presence of an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. The compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The amino group contributes to its reactivity, allowing for various substitution reactions. The carbonitrile functional group adds to the compound's polarity and can participate in nucleophilic reactions. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its unique structure may also impart specific pharmacological properties, making it a candidate for further research in therapeutic applications. As with many fluorinated compounds, it may exhibit distinct environmental and biological behaviors, necessitating careful consideration in its handling and application.
Formula:C5H2F3N3O
InChI:InChI=1/C5H2F3N3O/c6-5(7,8)4-11-2(1-9)3(10)12-4/h10H2
SMILES:C(#N)c1c(N)oc(C(F)(F)F)n1
Synonyms:
  • 4-Oxazolecarbonitrile, 5-amino-2-(trifluoromethyl)-
  • 5-Amino-2-(trifluoromethyl)-1,3-oxazole-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.