CAS 90761-62-9
:N-(3,5-dinitrobenzoyl)-L-alpha-phenyl-glycine
Description:
N-(3,5-dinitrobenzoyl)-L-alpha-phenyl-glycine, with the CAS number 90761-62-9, is a chemical compound that belongs to the class of amino acid derivatives. It features a phenyl group attached to the alpha carbon of the glycine backbone, which is further modified by the presence of a 3,5-dinitrobenzoyl moiety. This compound is characterized by its distinctive functional groups, including nitro groups that contribute to its reactivity and potential applications in various chemical reactions. The presence of the dinitrobenzoyl group enhances its electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities due to its structural features, which could be of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, N-(3,5-dinitrobenzoyl)-L-alpha-phenyl-glycine is a versatile compound with potential utility in both research and industrial settings.
Formula:C15H11N3O7
InChI:InChI=1/C15H11N3O7/c19-14(16-13(15(20)21)9-4-2-1-3-5-9)10-6-11(17(22)23)8-12(7-10)18(24)25/h1-8,13H,(H,16,19)(H,20,21)/t13-/m0/s1
SMILES:c1ccc(cc1)[C@@H](C(=O)O)N=C(c1cc(cc(c1)N(=O)=O)N(=O)=O)O
Synonyms:- (S)-(+)-N-(3,5-Dinitrobenzoyl)-α-phenylglycine
- (S)-(+)-N-(3,5-Dinitrobenzoyl)-alpha-phenylglycine
- (2S)-{[(3,5-dinitrophenyl)carbonyl]amino}(phenyl)ethanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-(+)-N-(3,5-Dinitrobenzoyl)-α-phenylglycine
CAS:Formula:C15H11N3O7Purity:95%Color and Shape:SolidMolecular weight:345.2637(S)-2-(3,5-Dinitrobenzamido)-2-phenylacetic acid
CAS:(S)-2-(3,5-Dinitrobenzamido)-2-phenylacetic acidPurity:98%Molecular weight:345.26g/mol(S)-(+)-N-(3,5-Dinitrobenzoyl)-α-phenylglycine
CAS:Formula:C15H11N3O7Purity:≥ 98.0%Color and Shape:White to light yellow powderMolecular weight:345.26(S)-(+)-N-(3,5-Dinitrobenzoyl)-alpha-phenylglycine
CAS:(S)-(+)-N-(3,5-Dinitrobenzoyl)-alpha-phenylglycine is a chiral compound that is made up of two enantiomers. It has been shown to be a potent anthelmintic drug, but it is not currently used clinically due to its high toxicity. This compound destroys the parasite's gut lining by reacting with sulfoxide and capillaries in the intestine. The sulfoxide reacts with the pyrrole to form a sulfoxonium ion, which reacts with amino acid residues in the parasite's cell membrane to form a covalent bond. This reaction disrupts the integrity of the parasite's cell membrane and leads to cell death.Formula:C15H11N3O7Purity:Min. 95%Color and Shape:White PowderMolecular weight:345.26 g/mol




