CAS 90771-56-5

5-Methyl-7-nitro-1H-indole-2-carboxylic acid

Description:

5-Methyl-7-nitro-1H-indole-2-carboxylic acid, with the CAS number 90771-56-5, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a methyl group at the 5-position, a nitro group at the 7-position, and a carboxylic acid functional group at the 2-position of the indole ring. The presence of these functional groups contributes to its unique chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial or anti-inflammatory effects, making them of interest in pharmaceutical research. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the indole structure may impart some degree of hydrophobicity. Additionally, its stability and reactivity can be influenced by the electron-withdrawing nitro group, which can affect its interaction with biological targets. Overall, 5-Methyl-7-nitro-1H-indole-2-carboxylic acid is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₀H₈N₂O₄

InChI: InChI=1S/C10H8N2O4/c1-5-2-6-4-7(10(13)14)11-9(6)8(3-5)12(15)16/h2-4,11H,1H3,(H,13,14)

InChI key: InChIKey=QDUDZZYFDPINJW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C=C(C(O)=O)N2)=CC(C)=C1

Synonyms:

• 5-Methyl-7-nitro-1H-indole-2-carboxylic acid
• 1H-Indole-2-carboxylic acid, 5-methyl-7-nitro-
• Indole-2-carboxylic acid, 5-methyl-7-nitro-