CAS 90772-55-7

1-bromo-2-ethynyl-4,5-dimethoxy-benzene

Description:

1-Bromo-2-ethynyl-4,5-dimethoxy-benzene is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an ethynyl group attached to a benzene ring that also features two methoxy groups. The presence of the bromine atom introduces a halogen functionality, which can enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions. The ethynyl group contributes to the compound's alkyne characteristics, allowing for potential applications in coupling reactions or as a building block in organic synthesis. The methoxy groups, being electron-donating, can influence the electronic properties of the benzene ring, potentially affecting its reactivity and stability. This compound may be utilized in the synthesis of more complex organic molecules, particularly in the fields of medicinal chemistry and materials science. Its unique combination of functional groups makes it a valuable intermediate in various synthetic pathways. As with many organic compounds, handling should be done with care, considering safety and environmental regulations.

Formula: C₁₀H₉BrO₂

InChI: InChI=1/C10H9BrO2/c1-4-7-5-9(12-2)10(13-3)6-8(7)11/h1,5-6H,2-3H3